4,4′-Dichlorodiphenylmethanol

Structural formula
Business number | 022V |
---|---|
Molecular formula | C13H10Cl2O |
Molecular weight | 253.12 |
label |
4,4′-dichlorodibenzyl alcohol, Bis(4-chlorophenyl)carbinol, (ClC6H4)2CHOH |
Numbering system
CAS number:90-97-1
MDL number:MFCD00000629
EINECS number:202-029-6
RTECS number:None
BRN number:1878717
PubChem number:24847134
Physical property data
1. Characteristics: milky white to light brown powder.
2. Density ( g/mL,25/4℃) : Undetermined
3. Relative vapor density (g/mL,AIR=1): Undetermined
4. Melting point ( ºC) : 91-95
5. Boiling point ( ºC,Normal pressure): Undetermined
6. Boiling point ( ºC,5.2kPa): Undetermined
7. Refractive Index: Undetermined
8. Flashpoint (ºC): Undetermined
9. Specific optical rotation (º): Undetermined
10. Autoignition point or ignition temperature (ºC): Not OK
11. Vapor pressure (kPa,25ºC): Undetermined
12. Explosion limit (%,V/V): Undetermined
18. Lower explosion limit (%,V/V): Not OK
19. Solubility: Undetermined
Toxicological data
None
Ecological data
None
Molecular structure data
1. Molar refractive index:66.89
2. Molar volume (m3/mol):190.9
3. Isotonic specific volume (90.2K): 505.4
4. Surface tension (dyne/cm): 49.0
5. Polarizability(10-24 cm3):26.51
Compute chemical data
1. Reference value for hydrophobic parameter calculation (XlogP): None
2. Number of hydrogen bond donors: 1
3. Number of hydrogen bond acceptors: 1
4. Number of rotatable chemical bonds: 2
5. Number of tautomers: none
6. Topological molecule polar surface area 20.2
7. Number of heavy atoms: 16
8. Surface charge: 0
9. Complexity: 184
10. Number of isotope atoms: 0
11. Determine the number of atomic stereocenters: 0
12. Uncertain number of atomic stereocenters: 0
13. Determine the number of chemical bond stereocenters: 0
14. Number of uncertain chemical bond stereocenters: 0
15. Number of covalent bond units: 1
Properties and stability
None
Storage method
This product should be sealed and stored in a cool place.
Synthesis method
None
Purpose
Organic synthesis.
yle=”FONT-SIZE: 9pt; FONT-FAMILY: 宋体; mso-ascii-font-family: Arial; mso-hansi-font-family: Arial; mso-bidi-font-family: Arial”>):505.4
4. Surface tension (dyne/cm): 49.0
5. Polarizability(10-24 cm3):26.51
Compute chemical data
1. Reference value for hydrophobic parameter calculation (XlogP): None
2. Number of hydrogen bond donors: 1
3. Number of hydrogen bond acceptors: 1
4. Number of rotatable chemical bonds: 2
5. Number of tautomers: none
6. Topological molecule polar surface area 20.2
7. Number of heavy atoms: 16
8. Surface charge: 0
9. Complexity: 184
10. Number of isotope atoms: 0
11. Determine the number of atomic stereocenters: 0
12. Uncertain number of atomic stereocenters: 0
13. Determine the number of chemical bond stereocenters: 0
14. Number of uncertain chemical bond stereocenters: 0
15. Number of covalent bond units: 1
Properties and stability
None
Storage method
This product should be sealed and stored in a cool place.
Synthesis method
None
Purpose
Organic synthesis.